C32H39ClN2O4 — CID 66717550
2-butyl-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1-carboxylic acid (PubChem CID 66717550) has the molecular formula C32H39ClN2O4 and a molecular weight of 551.13 g/mol. Its IUPAC name is 2-butyl-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1-carboxylic acid.
| Compound Name | 2-butyl-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66717550 |
| Molecular Formula | C32H39ClN2O4 |
| Molecular Weight | 551.13 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 2-butyl-3-[2-chloro-4-[2-(3-methoxypropyl)phenyl]phenyl]-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-1-carboxylic acid |
| SMILES | CCCCC1C(c2ccc(-c3ccccc3CCCOC)cc2Cl)C(c2ccn(C)c(=O)c2)CCN1C(=O)O |
| InChI | InChI=1S/C32H39ClN2O4/c1-4-5-12-29-31(26(16-18-35(29)32(37)38)24-15-17-34(2)30(36)21-24)27-14-13-23(20-28(27)33)25-11-7-6-9-22(25)10-8-19-39-3/h6-7,9,11,13-15,17,20-21,26,29,31H,4-5,8,10,12,16,18-19H2,1-3H3,(H,37,38) |
| InChIKey | FKYJOAUIZOTIIE-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.13 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|