About 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate
3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate (PubChem CID 66717841) has the molecular formula C22H18Br2N2O4S
and a molecular weight of 566.27 g/mol. Its IUPAC name is 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate.
Molecular Properties
| Compound Name | 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate |
| PubChem CID | 66717841 |
| Molecular Formula | C22H18Br2N2O4S |
| Molecular Weight | 566.27 g/mol |
| Exact Mass | 563.94 |
| IUPAC Name | 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate |
| SMILES | COC(=O)C(Oc1ccc2ncc(Br)cc2c1)SC.Oc1ccc2ncc(Br)cc2c1 |
| InChI | InChI=1S/C13H12BrNO3S.C9H6BrNO/c1-17-12(16)13(19-2)18-10-3-4-11-8(6-10)5-9(14)7-15-11;10-7-3-6-4-8(12)1-2-9(6)11-5-7/h3-7,13H,1-2H3;1-5,12H |
| InChIKey | NJFUHUCIVYDBGF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.27 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate?
The IUPAC name of 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate (CID 66717841) is 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate.
What is the SMILES notation for 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate?
The canonical SMILES for 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate is COC(=O)C(Oc1ccc2ncc(Br)cc2c1)SC.Oc1ccc2ncc(Br)cc2c1.
What is the InChIKey of 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate?
The InChIKey is NJFUHUCIVYDBGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrNO3S.C9H6BrNO/c1-17-12(16)13(19-2)18-10-3-4-11-8(6-10)5-9(14)7-15-11;10-7-3-6-4-8(12)1-2-9(6)11-5-7/h3-7,13H,1-2H3;1-5,12H.
What are the key properties of 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate?
3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate has a molecular weight of 566.27 g/mol, XLogP of 5.94, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoquinolin-6-ol;methyl 2-(3-bromoquinolin-6-yl)oxy-2-methylsulfanylacetate is sourced from PubChem (CID 66717841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).