About 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride
2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride (PubChem CID 66718047) has the molecular formula C8H18Cl2N2O
and a molecular weight of 229.15 g/mol. Its IUPAC name is 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride.
Molecular Properties
| Compound Name | 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride |
| PubChem CID | 66718047 |
| Molecular Formula | C8H18Cl2N2O |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride |
| SMILES | CC(C)C1=NCC(CCO)N1.Cl.Cl |
| InChI | InChI=1S/C8H16N2O.2ClH/c1-6(2)8-9-5-7(10-8)3-4-11;;/h6-7,11H,3-5H2,1-2H3,(H,9,10);2*1H |
| InChIKey | JLZGZDPNPWICGW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride?
The IUPAC name of 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride (CID 66718047) is 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride.
What is the SMILES notation for 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride?
The canonical SMILES for 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride is CC(C)C1=NCC(CCO)N1.Cl.Cl.
What is the InChIKey of 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride?
The InChIKey is JLZGZDPNPWICGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.2ClH/c1-6(2)8-9-5-7(10-8)3-4-11;;/h6-7,11H,3-5H2,1-2H3,(H,9,10);2*1H.
What are the key properties of 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride?
2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride has a molecular weight of 229.15 g/mol, XLogP of 1.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propan-2-yl-4,5-dihydro-1H-imidazol-5-yl)ethanol;dihydrochloride is sourced from PubChem (CID 66718047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).