C36H34ClN3O7 — CID 6671810
(2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6671810) has the molecular formula C36H34ClN3O7 and a molecular weight of 656.14 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6671810 |
| Molecular Formula | C36H34ClN3O7 |
| Molecular Weight | 656.14 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | (2R,3S,4S)-4-(1-acetylindol-3-yl)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-ethoxy-3-(3-hydroxypropyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)Nc2ccc(N3C(=O)c4ccc(Cl)cc4C3=O)c(C)c2)=C[C@H](c2cn(C(C)=O)c3ccccc23)[C@@H]1CCCO |
| InChI | InChI=1S/C36H34ClN3O7/c1-4-46-36-26(9-7-15-41)27(29-19-39(21(3)42)31-10-6-5-8-24(29)31)18-32(47-36)33(43)38-23-12-14-30(20(2)16-23)40-34(44)25-13-11-22(37)17-28(25)35(40)45/h5-6,8,10-14,16-19,26-27,36,41H,4,7,9,15H2,1-3H3,(H,38,43)/t26-,27-,36+/m0/s1 |
| InChIKey | FBPPJDYUSBOHHO-POEUFYPISA-N |
| XLogP | 6.45 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.14 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|