C15H17ClN6O — CID 66718365
1-[6-[(5-amino-7-chloro-2H-triazolo[4,5-c]pyridin-3-yl)methyl]-2-pyridinyl]cyclobutan-1-ol (PubChem CID 66718365) has the molecular formula C15H17ClN6O and a molecular weight of 332.80 g/mol. Its IUPAC name is 1-[6-[(5-amino-7-chloro-2H-triazolo[4,5-c]pyridin-3-yl)methyl]-2-pyridinyl]cyclobutan-1-ol.
| Compound Name | 1-[6-[(5-amino-7-chloro-2H-triazolo[4,5-c]pyridin-3-yl)methyl]-2-pyridinyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 66718365 |
| Molecular Formula | C15H17ClN6O |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[6-[(5-amino-7-chloro-2H-triazolo[4,5-c]pyridin-3-yl)methyl]-2-pyridinyl]cyclobutan-1-ol |
| SMILES | NN1C=C(Cl)C2=NNN(Cc3cccc(C4(O)CCC4)n3)C2=C1 |
| InChI | InChI=1S/C15H17ClN6O/c16-11-8-21(17)9-12-14(11)19-20-22(12)7-10-3-1-4-13(18-10)15(23)5-2-6-15/h1,3-4,8-9,20,23H,2,5-7,17H2 |
| InChIKey | RYOSGWDAOJAGEM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|