C33H28Cl2N2O9S — CID 66719471
methyl (2S)-3-[6-[(6R)-6-[4-[(3,4-dichlorophenyl)methoxy]phenyl]cyclohexa-1,3-dien-1-yl]-1,4-dioxin-2-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate (PubChem CID 66719471) has the molecular formula C33H28Cl2N2O9S and a molecular weight of 699.56 g/mol. Its IUPAC name is methyl (2S)-3-[6-[(6R)-6-[4-[(3,4-dichlorophenyl)methoxy]phenyl]cyclohexa-1,3-dien-1-yl]-1,4-dioxin-2-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S)-3-[6-[(6R)-6-[4-[(3,4-dichlorophenyl)methoxy]phenyl]cyclohexa-1,3-dien-1-yl]-1,4-dioxin-2-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 66719471 |
| Molecular Formula | C33H28Cl2N2O9S |
| Molecular Weight | 699.56 g/mol |
| Exact Mass | 698.09 |
| IUPAC Name | methyl (2S)-3-[6-[(6R)-6-[4-[(3,4-dichlorophenyl)methoxy]phenyl]cyclohexa-1,3-dien-1-yl]-1,4-dioxin-2-yl]-2-[(4-nitrophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](CC1=COC=C(C2=CC=CC[C@@H]2c2ccc(OCc3ccc(Cl)c(Cl)c3)cc2)O1)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H28Cl2N2O9S/c1-43-33(38)31(36-47(41,42)26-13-9-23(10-14-26)37(39)40)17-25-19-44-20-32(46-25)28-5-3-2-4-27(28)22-7-11-24(12-8-22)45-18-21-6-15-29(34)30(35)16-21/h2-3,5-16,19-20,27,31,36H,4,17-18H2,1H3/t27-,31+/m1/s1 |
| InChIKey | BTLGPSVJPLMJEF-JOMNFKBKSA-N |
| XLogP | 7.09 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.56 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|