About 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid
4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid (PubChem CID 66719501) has the molecular formula C18H14Cl2F3NO2
and a molecular weight of 404.22 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid |
| PubChem CID | 66719501 |
| Molecular Formula | C18H14Cl2F3NO2 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C18H14Cl2F3NO2/c19-13-7-12(8-14(20)9-13)17(18(21,22)23)5-6-24(10-17)15-3-1-11(2-4-15)16(25)26/h1-4,7-9H,5-6,10H2,(H,25,26) |
| InChIKey | CLXTWVSDWUXMMT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid?
The IUPAC name of 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid (CID 66719501) is 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid.
What is the SMILES notation for 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid?
The canonical SMILES for 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid is O=C(O)c1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1.
What is the InChIKey of 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid?
The InChIKey is CLXTWVSDWUXMMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2F3NO2/c19-13-7-12(8-14(20)9-13)17(18(21,22)23)5-6-24(10-17)15-3-1-11(2-4-15)16(25)26/h1-4,7-9H,5-6,10H2,(H,25,26).
What are the key properties of 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid?
4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid has a molecular weight of 404.22 g/mol, XLogP of 5.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]benzoic acid is sourced from PubChem (CID 66719501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).