About [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine
[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine (PubChem CID 66719716) has the molecular formula C18H18Cl2F3N3
and a molecular weight of 404.26 g/mol. Its IUPAC name is [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine.
Molecular Properties
| Compound Name | [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine |
| PubChem CID | 66719716 |
| Molecular Formula | C18H18Cl2F3N3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine |
| SMILES | Cc1cc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1NN |
| InChI | InChI=1S/C18H18Cl2F3N3/c1-11-6-15(2-3-16(11)25-24)26-5-4-17(10-26,18(21,22)23)12-7-13(19)9-14(20)8-12/h2-3,6-9,25H,4-5,10,24H2,1H3 |
| InChIKey | DGKNJTZJYQSKCP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine?
The IUPAC name of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine (CID 66719716) is [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine.
What is the SMILES notation for [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine?
The canonical SMILES for [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine is Cc1cc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1NN.
What is the InChIKey of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine?
The InChIKey is DGKNJTZJYQSKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2F3N3/c1-11-6-15(2-3-16(11)25-24)26-5-4-17(10-26,18(21,22)23)12-7-13(19)9-14(20)8-12/h2-3,6-9,25H,4-5,10,24H2,1H3.
What are the key properties of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine?
[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine has a molecular weight of 404.26 g/mol, XLogP of 5.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-methylphenyl]hydrazine is sourced from PubChem (CID 66719716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).