C30H32N6O3 — CID 66720004
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[4-(diethylaminomethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 66720004) has the molecular formula C30H32N6O3 and a molecular weight of 524.63 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[4-(diethylaminomethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[4-(diethylaminomethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66720004 |
| Molecular Formula | C30H32N6O3 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-[3-[4-(diethylaminomethyl)phenyl]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CCN(CC)Cc1ccc(-c2ccn(-c3ncccc3C(=O)NC(Cc3ccccc3)C(=O)C(N)=O)n2)cc1 |
| InChI | InChI=1S/C30H32N6O3/c1-3-35(4-2)20-22-12-14-23(15-13-22)25-16-18-36(34-25)29-24(11-8-17-32-29)30(39)33-26(27(37)28(31)38)19-21-9-6-5-7-10-21/h5-18,26H,3-4,19-20H2,1-2H3,(H2,31,38)(H,33,39) |
| InChIKey | CDTXTLFGVZEJDY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|