C25H27N5O3 — CID 66720064
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(3-cyclohexylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 66720064) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(3-cyclohexylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(3-cyclohexylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66720064 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-(3-cyclohexylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(C2CCCCC2)n1 |
| InChI | InChI=1S/C25H27N5O3/c26-23(32)22(31)21(16-17-8-3-1-4-9-17)28-25(33)19-12-7-14-27-24(19)30-15-13-20(29-30)18-10-5-2-6-11-18/h1,3-4,7-9,12-15,18,21H,2,5-6,10-11,16H2,(H2,26,32)(H,28,33) |
| InChIKey | HEFPUCSICREODM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|