C18H25N2+ — CID 66720081
1,1,2,4,5-pentakis(prop-2-enyl)imidazol-1-ium (PubChem CID 66720081) has the molecular formula C18H25N2+ and a molecular weight of 269.41 g/mol. Its IUPAC name is 1,1,2,4,5-pentakis(prop-2-enyl)imidazol-1-ium.
| Compound Name | 1,1,2,4,5-pentakis(prop-2-enyl)imidazol-1-ium |
|---|---|
| PubChem CID | 66720081 |
| Molecular Formula | C18H25N2+ |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1,1,2,4,5-pentakis(prop-2-enyl)imidazol-1-ium |
| SMILES | C=CCC1=NC(CC=C)=C(CC=C)[N+]1(CC=C)CC=C |
| InChI | InChI=1S/C18H25N2/c1-6-11-16-17(12-7-2)20(14-9-4,15-10-5)18(19-16)13-8-3/h6-10H,1-5,11-15H2/q+1 |
| InChIKey | QNHZULKICQCBNO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|