C18H25F3N4O4S — CID 66720223
(1,1-dihydroxy-1,4-thiazinan-4-yl)-[2-[[(1S,2S,3S,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-4-(trifluoromethyl)pyrimidin-5-yl]methanone (PubChem CID 66720223) has the molecular formula C18H25F3N4O4S and a molecular weight of 450.48 g/mol. Its IUPAC name is (1,1-dihydroxy-1,4-thiazinan-4-yl)-[2-[[(1S,2S,3S,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-4-(trifluoromethyl)pyrimidin-5-yl]methanone.
| Compound Name | (1,1-dihydroxy-1,4-thiazinan-4-yl)-[2-[[(1S,2S,3S,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-4-(trifluoromethyl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 66720223 |
| Molecular Formula | C18H25F3N4O4S |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (1,1-dihydroxy-1,4-thiazinan-4-yl)-[2-[[(1S,2S,3S,4R)-3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-4-(trifluoromethyl)pyrimidin-5-yl]methanone |
| SMILES | O=C(c1cnc(N[C@H]2[C@H]3CC[C@H](C3)[C@@H]2CO)nc1C(F)(F)F)N1CCS(O)(O)CC1 |
| InChI | InChI=1S/C18H25F3N4O4S/c19-18(20,21)15-12(16(27)25-3-5-30(28,29)6-4-25)8-22-17(24-15)23-14-11-2-1-10(7-11)13(14)9-26/h8,10-11,13-14,26,28-29H,1-7,9H2,(H,22,23,24)/t10-,11+,13+,14+/m1/s1 |
| InChIKey | UPJCTPKZXSPJBZ-XWUBHJNHSA-N |
| XLogP | 2.52 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |