About N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide (PubChem CID 66720314) has the molecular formula C23H19N5O3
and a molecular weight of 413.44 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide |
| PubChem CID | 66720314 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1cc2ccccc2n1 |
| InChI | InChI=1S/C23H19N5O3/c24-21(30)20(29)19(13-15-7-2-1-3-8-15)26-23(31)17-10-6-12-25-22(17)28-14-16-9-4-5-11-18(16)27-28/h1-12,14,19H,13H2,(H2,24,30)(H,26,31) |
| InChIKey | VMXDOKVLGKHPAC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide?
The IUPAC name of N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide (CID 66720314) is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide.
What is the SMILES notation for N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide?
The canonical SMILES for N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide is NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1cc2ccccc2n1.
What is the InChIKey of N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide?
The InChIKey is VMXDOKVLGKHPAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5O3/c24-21(30)20(29)19(13-15-7-2-1-3-8-15)26-23(31)17-10-6-12-25-22(17)28-14-16-9-4-5-11-18(16)27-28/h1-12,14,19H,13H2,(H2,24,30)(H,26,31).
What are the key properties of N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide?
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide has a molecular weight of 413.44 g/mol, XLogP of 1.82, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-indazol-2-ylpyridine-3-carboxamide is sourced from PubChem (CID 66720314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).