C25H29NO6 — CID 6672051
(2S,3R,4R)-N-(1,3-benzodioxol-5-ylmethyl)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6672051) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is (2S,3R,4R)-N-(1,3-benzodioxol-5-ylmethyl)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,3R,4R)-N-(1,3-benzodioxol-5-ylmethyl)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6672051 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (2S,3R,4R)-N-(1,3-benzodioxol-5-ylmethyl)-2-ethoxy-3-(3-hydroxypropyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@H]1OC(C(=O)NCc2ccc3c(c2)OCO3)=C[C@@H](c2ccccc2)[C@H]1CCCO |
| InChI | InChI=1S/C25H29NO6/c1-2-29-25-19(9-6-12-27)20(18-7-4-3-5-8-18)14-23(32-25)24(28)26-15-17-10-11-21-22(13-17)31-16-30-21/h3-5,7-8,10-11,13-14,19-20,25,27H,2,6,9,12,15-16H2,1H3,(H,26,28)/t19-,20+,25+/m1/s1 |
| InChIKey | VCTVXUREXBOPIH-RNHFSVANSA-N |
| XLogP | 3.48 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |