About [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride
[(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride (PubChem CID 66720584) has the molecular formula C12H17Cl2N3
and a molecular weight of 274.20 g/mol. Its IUPAC name is [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride |
| PubChem CID | 66720584 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc2c([C@H]3C[C@@H]3CN)cccc2n1 |
| InChI | InChI=1S/C12H15N3.2ClH/c1-15-7-11-9(10-5-8(10)6-13)3-2-4-12(11)14-15;;/h2-4,7-8,10H,5-6,13H2,1H3;2*1H/t8-,10+;;/m1../s1 |
| InChIKey | FAXGNCMLPVWLHA-WAZPLGGWSA-N |
| XLogP | 2.48 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride?
The IUPAC name of [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride (CID 66720584) is [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride.
What is the SMILES notation for [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride?
The canonical SMILES for [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride is Cl.Cl.Cn1cc2c([C@H]3C[C@@H]3CN)cccc2n1.
What is the InChIKey of [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride?
The InChIKey is FAXGNCMLPVWLHA-WAZPLGGWSA-N. The full InChI is InChI=1S/C12H15N3.2ClH/c1-15-7-11-9(10-5-8(10)6-13)3-2-4-12(11)14-15;;/h2-4,7-8,10H,5-6,13H2,1H3;2*1H/t8-,10+;;/m1../s1.
What are the key properties of [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride?
[(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride has a molecular weight of 274.20 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-(2-methylindazol-4-yl)cyclopropyl]methanamine;dihydrochloride is sourced from PubChem (CID 66720584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).