About [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate
[3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate (PubChem CID 66720642) has the molecular formula C13H13F5N2O2
and a molecular weight of 324.25 g/mol. Its IUPAC name is [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate |
| PubChem CID | 66720642 |
| Molecular Formula | C13H13F5N2O2 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate |
| SMILES | O=C(OCc1cc(F)c(F)c(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C13H13F5N2O2/c14-10-6-8(5-9(11(10)15)13(16,17)18)7-22-12(21)20-3-1-19-2-4-20/h5-6,19H,1-4,7H2 |
| InChIKey | JCSDATJRMPILJG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate?
The IUPAC name of [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate (CID 66720642) is [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate.
What is the SMILES notation for [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate?
The canonical SMILES for [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate is O=C(OCc1cc(F)c(F)c(C(F)(F)F)c1)N1CCNCC1.
What is the InChIKey of [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate?
The InChIKey is JCSDATJRMPILJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F5N2O2/c14-10-6-8(5-9(11(10)15)13(16,17)18)7-22-12(21)20-3-1-19-2-4-20/h5-6,19H,1-4,7H2.
What are the key properties of [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate?
[3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate has a molecular weight of 324.25 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-difluoro-5-(trifluoromethyl)phenyl]methyl piperazine-1-carboxylate is sourced from PubChem (CID 66720642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).