About 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine
3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine (PubChem CID 66720785) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine |
| PubChem CID | 66720785 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2ncco2)c1 |
| InChI | InChI=1S/C9H9N3O/c10-7-2-1-3-8(6-7)12-9-11-4-5-13-9/h1-6H,10H2,(H,11,12) |
| InChIKey | BGXXLKNLLJELND-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine?
The IUPAC name of 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine (CID 66720785) is 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine.
What is the SMILES notation for 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine?
The canonical SMILES for 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine is Nc1cccc(Nc2ncco2)c1.
What is the InChIKey of 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine?
The InChIKey is BGXXLKNLLJELND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c10-7-2-1-3-8(6-7)12-9-11-4-5-13-9/h1-6H,10H2,(H,11,12).
What are the key properties of 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine?
3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine has a molecular weight of 175.19 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(1,3-oxazol-2-yl)benzene-1,3-diamine is sourced from PubChem (CID 66720785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).