C22H26FNO4S — CID 6672084
(2S,4S)-N-[2-(4-fluorophenyl)ethyl]-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6672084) has the molecular formula C22H26FNO4S and a molecular weight of 419.52 g/mol. Its IUPAC name is (2S,4S)-N-[2-(4-fluorophenyl)ethyl]-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-N-[2-(4-fluorophenyl)ethyl]-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6672084 |
| Molecular Formula | C22H26FNO4S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (2S,4S)-N-[2-(4-fluorophenyl)ethyl]-2-(4-hydroxybutoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)C1=C[C@@H](c2cccs2)C[C@@H](OCCCCO)O1 |
| InChI | InChI=1S/C22H26FNO4S/c23-18-7-5-16(6-8-18)9-10-24-22(26)19-14-17(20-4-3-13-29-20)15-21(28-19)27-12-2-1-11-25/h3-8,13-14,17,21,25H,1-2,9-12,15H2,(H,24,26)/t17-,21+/m1/s1 |
| InChIKey | TWKYCIZHYULIFI-UTKZUKDTSA-N |
| XLogP | 3.75 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|