About [3-(1,3-oxazol-2-ylamino)phenyl]urea
[3-(1,3-oxazol-2-ylamino)phenyl]urea (PubChem CID 66720962) has the molecular formula C10H10N4O2
and a molecular weight of 218.22 g/mol. Its IUPAC name is [3-(1,3-oxazol-2-ylamino)phenyl]urea.
Molecular Properties
| Compound Name | [3-(1,3-oxazol-2-ylamino)phenyl]urea |
| PubChem CID | 66720962 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [3-(1,3-oxazol-2-ylamino)phenyl]urea |
| SMILES | NC(=O)Nc1cccc(Nc2ncco2)c1 |
| InChI | InChI=1S/C10H10N4O2/c11-9(15)13-7-2-1-3-8(6-7)14-10-12-4-5-16-10/h1-6H,(H,12,14)(H3,11,13,15) |
| InChIKey | MGJAKLSGRBMOLQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(1,3-oxazol-2-ylamino)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-oxazol-2-ylamino)phenyl]urea?
The IUPAC name of [3-(1,3-oxazol-2-ylamino)phenyl]urea (CID 66720962) is [3-(1,3-oxazol-2-ylamino)phenyl]urea.
What is the SMILES notation for [3-(1,3-oxazol-2-ylamino)phenyl]urea?
The canonical SMILES for [3-(1,3-oxazol-2-ylamino)phenyl]urea is NC(=O)Nc1cccc(Nc2ncco2)c1.
What is the InChIKey of [3-(1,3-oxazol-2-ylamino)phenyl]urea?
The InChIKey is MGJAKLSGRBMOLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2/c11-9(15)13-7-2-1-3-8(6-7)14-10-12-4-5-16-10/h1-6H,(H,12,14)(H3,11,13,15).
What are the key properties of [3-(1,3-oxazol-2-ylamino)phenyl]urea?
[3-(1,3-oxazol-2-ylamino)phenyl]urea has a molecular weight of 218.22 g/mol, XLogP of 1.91, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-oxazol-2-ylamino)phenyl]urea is sourced from PubChem (CID 66720962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).