C22H26ClN3O3S — CID 667212
(3aR,6aS)-6'-chloro-5-cyclopentyl-7'-methyl-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 667212) has the molecular formula C22H26ClN3O3S and a molecular weight of 447.99 g/mol. Its IUPAC name is (3aR,6aS)-6'-chloro-5-cyclopentyl-7'-methyl-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | (3aR,6aS)-6'-chloro-5-cyclopentyl-7'-methyl-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 667212 |
| Molecular Formula | C22H26ClN3O3S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (3aR,6aS)-6'-chloro-5-cyclopentyl-7'-methyl-1-(2-methylsulfanylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CSCCC1NC2(C(=O)Nc3c2ccc(Cl)c3C)[C@@H]2C(=O)N(C3CCCC3)C(=O)[C@H]12 |
| InChI | InChI=1S/C22H26ClN3O3S/c1-11-14(23)8-7-13-18(11)24-21(29)22(13)17-16(15(25-22)9-10-30-2)19(27)26(20(17)28)12-5-3-4-6-12/h7-8,12,15-17,25H,3-6,9-10H2,1-2H3,(H,24,29)/t15?,16-,17+,22?/m1/s1 |
| InChIKey | LYQARSBUUHENRK-IZCOPSDLSA-N |
| XLogP | 3.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|