C13H15F3N2O3 — CID 66721340
4-[3-amino-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylic acid (PubChem CID 66721340) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is 4-[3-amino-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[3-amino-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66721340 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-[3-amino-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylic acid |
| SMILES | Nc1cc(OC2CCN(C(=O)O)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O3/c14-13(15,16)8-5-9(17)7-11(6-8)21-10-1-3-18(4-2-10)12(19)20/h5-7,10H,1-4,17H2,(H,19,20) |
| InChIKey | AYVYGUHFQBDIEI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|