C29H30N4O6S2 — CID 66721703
4-[[7-[[2,5-dimethyl-4-(thiophen-2-ylmethylsulfamoyl)furan-3-carbonyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N-methylpyridine-2-carboxamide (PubChem CID 66721703) has the molecular formula C29H30N4O6S2 and a molecular weight of 594.72 g/mol. Its IUPAC name is 4-[[7-[[2,5-dimethyl-4-(thiophen-2-ylmethylsulfamoyl)furan-3-carbonyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[[7-[[2,5-dimethyl-4-(thiophen-2-ylmethylsulfamoyl)furan-3-carbonyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 66721703 |
| Molecular Formula | C29H30N4O6S2 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 4-[[7-[[2,5-dimethyl-4-(thiophen-2-ylmethylsulfamoyl)furan-3-carbonyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3c(c2)CC(NC(=O)c2c(C)oc(C)c2S(=O)(=O)NCc2cccs2)CC3)ccn1 |
| InChI | InChI=1S/C29H30N4O6S2/c1-17-26(27(18(2)38-17)41(36,37)32-16-24-5-4-12-40-24)29(35)33-21-8-6-19-7-9-22(14-20(19)13-21)39-23-10-11-31-25(15-23)28(34)30-3/h4-5,7,9-12,14-15,21,32H,6,8,13,16H2,1-3H3,(H,30,34)(H,33,35) |
| InChIKey | IOYPAFXSPSSXCX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 139.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |