C19H21NO5S — CID 6672185
(2R,4R)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6672185) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is (2R,4R)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4R)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6672185 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (2R,4R)-N-(4-hydroxyphenyl)-2-(3-hydroxypropoxy)-4-thiophen-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1=C[C@H](c2cccs2)C[C@H](OCCCO)O1 |
| InChI | InChI=1S/C19H21NO5S/c21-8-2-9-24-18-12-13(17-3-1-10-26-17)11-16(25-18)19(23)20-14-4-6-15(22)7-5-14/h1,3-7,10-11,13,18,21-22H,2,8-9,12H2,(H,20,23)/t13-,18+/m0/s1 |
| InChIKey | KOWBZKVJTKIPPK-SCLBCKFNSA-N |
| XLogP | 3.21 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|