About (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene
(1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene (PubChem CID 66721969) has the molecular formula C12H11BrS
and a molecular weight of 267.19 g/mol. Its IUPAC name is (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene.
Molecular Properties
| Compound Name | (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene |
| PubChem CID | 66721969 |
| Molecular Formula | C12H11BrS |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene |
| SMILES | BrC1(Sc2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C12H11BrS/c13-12(9-5-2-6-10-12)14-11-7-3-1-4-8-11/h1-9H,10H2 |
| InChIKey | BMKKDXDTIILJLH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene?
The IUPAC name of (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene (CID 66721969) is (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene.
What is the SMILES notation for (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene?
The canonical SMILES for (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene is BrC1(Sc2ccccc2)C=CC=CC1.
What is the InChIKey of (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene?
The InChIKey is BMKKDXDTIILJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrS/c13-12(9-5-2-6-10-12)14-11-7-3-1-4-8-11/h1-9H,10H2.
What are the key properties of (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene?
(1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene has a molecular weight of 267.19 g/mol, XLogP of 4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-bromocyclohexa-2,4-dien-1-yl)sulfanylbenzene is sourced from PubChem (CID 66721969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).