About 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol
2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol (PubChem CID 66722128) has the molecular formula C24H34O5
and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol |
| PubChem CID | 66722128 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(Oc2cc(C(C)(C)O)cc(C(C)(C)O)c2)cc(C(C)(C)O)c1 |
| InChI | InChI=1S/C24H34O5/c1-21(2,25)15-9-16(22(3,4)26)12-19(11-15)29-20-13-17(23(5,6)27)10-18(14-20)24(7,8)28/h9-14,25-28H,1-8H3 |
| InChIKey | CZPZOUJIODZEAM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
The IUPAC name of 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol (CID 66722128) is 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol.
What is the SMILES notation for 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
The canonical SMILES for 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol is CC(C)(O)c1cc(Oc2cc(C(C)(C)O)cc(C(C)(C)O)c2)cc(C(C)(C)O)c1.
What is the InChIKey of 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
The InChIKey is CZPZOUJIODZEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34O5/c1-21(2,25)15-9-16(22(3,4)26)12-19(11-15)29-20-13-17(23(5,6)27)10-18(14-20)24(7,8)28/h9-14,25-28H,1-8H3.
What are the key properties of 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol has a molecular weight of 402.53 g/mol, XLogP of 4.39, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3,5-bis(2-hydroxypropan-2-yl)phenoxy]-5-(2-hydroxypropan-2-yl)phenyl]propan-2-ol is sourced from PubChem (CID 66722128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).