C24H35N3O2Si — CID 66722303
(5S)-2-(4-hydroxycyclohexyl)-9-[3-(2-trimethylsilylethynyl)-2-pyridinyl]-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 66722303) has the molecular formula C24H35N3O2Si and a molecular weight of 425.65 g/mol. Its IUPAC name is (5S)-2-(4-hydroxycyclohexyl)-9-[3-(2-trimethylsilylethynyl)-2-pyridinyl]-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | (5S)-2-(4-hydroxycyclohexyl)-9-[3-(2-trimethylsilylethynyl)-2-pyridinyl]-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 66722303 |
| Molecular Formula | C24H35N3O2Si |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (5S)-2-(4-hydroxycyclohexyl)-9-[3-(2-trimethylsilylethynyl)-2-pyridinyl]-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | C[Si](C)(C)C#Cc1cccnc1N1CCC[C@]2(CCN(C3CCC(O)CC3)C2=O)C1 |
| InChI | InChI=1S/C24H35N3O2Si/c1-30(2,3)17-11-19-6-4-14-25-22(19)26-15-5-12-24(18-26)13-16-27(23(24)29)20-7-9-21(28)10-8-20/h4,6,14,20-21,28H,5,7-10,12-13,15-16,18H2,1-3H3/t20?,21?,24-/m0/s1 |
| InChIKey | MHSQSZZZGNMUHN-VUNKPPBISA-N |
| XLogP | 3.43 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|