About 2,8-dichloroindolo[3,2-b]carbazole
2,8-dichloroindolo[3,2-b]carbazole (PubChem CID 66722443) has the molecular formula C18H8Cl2N2
and a molecular weight of 323.18 g/mol. Its IUPAC name is 2,8-dichloroindolo[3,2-b]carbazole.
Molecular Properties
| Compound Name | 2,8-dichloroindolo[3,2-b]carbazole |
| PubChem CID | 66722443 |
| Molecular Formula | C18H8Cl2N2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2,8-dichloroindolo[3,2-b]carbazole |
| SMILES | Clc1ccc2c(c1)=c1cc3c(cc1N=2)=c1cc(Cl)ccc1=N3 |
| InChI | InChI=1S/C18H8Cl2N2/c19-9-1-3-15-11(5-9)13-7-18-14(8-17(13)21-15)12-6-10(20)2-4-16(12)22-18/h1-8H |
| InChIKey | OSGXTRXWRKBRHL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8-dichloroindolo[3,2-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dichloroindolo[3,2-b]carbazole?
The IUPAC name of 2,8-dichloroindolo[3,2-b]carbazole (CID 66722443) is 2,8-dichloroindolo[3,2-b]carbazole.
What is the SMILES notation for 2,8-dichloroindolo[3,2-b]carbazole?
The canonical SMILES for 2,8-dichloroindolo[3,2-b]carbazole is Clc1ccc2c(c1)=c1cc3c(cc1N=2)=c1cc(Cl)ccc1=N3.
What is the InChIKey of 2,8-dichloroindolo[3,2-b]carbazole?
The InChIKey is OSGXTRXWRKBRHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8Cl2N2/c19-9-1-3-15-11(5-9)13-7-18-14(8-17(13)21-15)12-6-10(20)2-4-16(12)22-18/h1-8H.
What are the key properties of 2,8-dichloroindolo[3,2-b]carbazole?
2,8-dichloroindolo[3,2-b]carbazole has a molecular weight of 323.18 g/mol, XLogP of 4.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dichloroindolo[3,2-b]carbazole is sourced from PubChem (CID 66722443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).