About 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole
4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole (PubChem CID 66722853) has the molecular formula C23H44N2
and a molecular weight of 348.62 g/mol. Its IUPAC name is 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole.
Molecular Properties
| Compound Name | 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole |
| PubChem CID | 66722853 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole |
| SMILES | CCCCCC(C)(C)c1nc(C(C)(C)C)c(C(C)(C)CCCCC)[nH]1 |
| InChI | InChI=1S/C23H44N2/c1-10-12-14-16-22(6,7)19-18(21(3,4)5)24-20(25-19)23(8,9)17-15-13-11-2/h10-17H2,1-9H3,(H,24,25) |
| InChIKey | SMBKGOVYSYVJRY-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole?
The IUPAC name of 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole (CID 66722853) is 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole.
What is the SMILES notation for 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole?
The canonical SMILES for 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole is CCCCCC(C)(C)c1nc(C(C)(C)C)c(C(C)(C)CCCCC)[nH]1.
What is the InChIKey of 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole?
The InChIKey is SMBKGOVYSYVJRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44N2/c1-10-12-14-16-22(6,7)19-18(21(3,4)5)24-20(25-19)23(8,9)17-15-13-11-2/h10-17H2,1-9H3,(H,24,25).
What are the key properties of 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole?
4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole has a molecular weight of 348.62 g/mol, XLogP of 7.42, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,5-bis(2-methylheptan-2-yl)-1H-imidazole is sourced from PubChem (CID 66722853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).