About 6,12-dimethylindolo[3,2-b]carbazole
6,12-dimethylindolo[3,2-b]carbazole (PubChem CID 66723768) has the molecular formula C20H14N2
and a molecular weight of 282.35 g/mol. Its IUPAC name is 6,12-dimethylindolo[3,2-b]carbazole.
Molecular Properties
| Compound Name | 6,12-dimethylindolo[3,2-b]carbazole |
| PubChem CID | 66723768 |
| Molecular Formula | C20H14N2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 6,12-dimethylindolo[3,2-b]carbazole |
| SMILES | Cc1c2c(c(C)c3c1=c1ccccc1=N3)=c1ccccc1=N2 |
| InChI | InChI=1S/C20H14N2/c1-11-17-13-7-3-5-9-15(13)22-20(17)12(2)18-14-8-4-6-10-16(14)21-19(11)18/h3-10H,1-2H3 |
| InChIKey | HWWVBEDFBAMCOP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,12-dimethylindolo[3,2-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,12-dimethylindolo[3,2-b]carbazole?
The IUPAC name of 6,12-dimethylindolo[3,2-b]carbazole (CID 66723768) is 6,12-dimethylindolo[3,2-b]carbazole.
What is the SMILES notation for 6,12-dimethylindolo[3,2-b]carbazole?
The canonical SMILES for 6,12-dimethylindolo[3,2-b]carbazole is Cc1c2c(c(C)c3c1=c1ccccc1=N3)=c1ccccc1=N2.
What is the InChIKey of 6,12-dimethylindolo[3,2-b]carbazole?
The InChIKey is HWWVBEDFBAMCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2/c1-11-17-13-7-3-5-9-15(13)22-20(17)12(2)18-14-8-4-6-10-16(14)21-19(11)18/h3-10H,1-2H3.
What are the key properties of 6,12-dimethylindolo[3,2-b]carbazole?
6,12-dimethylindolo[3,2-b]carbazole has a molecular weight of 282.35 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,12-dimethylindolo[3,2-b]carbazole is sourced from PubChem (CID 66723768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).