C16H16Cl3NO3 — CID 66725043
(3R)-4-amino-3-[4-chloro-3-(3-chloro-4-hydroxyphenyl)phenyl]butanoic acid;hydrochloride (PubChem CID 66725043) has the molecular formula C16H16Cl3NO3 and a molecular weight of 376.67 g/mol. Its IUPAC name is (3R)-4-amino-3-[4-chloro-3-(3-chloro-4-hydroxyphenyl)phenyl]butanoic acid;hydrochloride.
| Compound Name | (3R)-4-amino-3-[4-chloro-3-(3-chloro-4-hydroxyphenyl)phenyl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66725043 |
| Molecular Formula | C16H16Cl3NO3 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | (3R)-4-amino-3-[4-chloro-3-(3-chloro-4-hydroxyphenyl)phenyl]butanoic acid;hydrochloride |
| SMILES | Cl.NC[C@H](CC(=O)O)c1ccc(Cl)c(-c2ccc(O)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H15Cl2NO3.ClH/c17-13-3-1-9(11(8-19)7-16(21)22)5-12(13)10-2-4-15(20)14(18)6-10;/h1-6,11,20H,7-8,19H2,(H,21,22);1H/t11-;/m0./s1 |
| InChIKey | JTECOOMFMFEVKD-MERQFXBCSA-N |
| XLogP | 4.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |