C16H23ClN2 — CID 66725208
4-(4-amino-3-methylphenyl)-2,6,6-trimethylcyclohexa-1,3-dien-1-amine;hydrochloride (PubChem CID 66725208) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 4-(4-amino-3-methylphenyl)-2,6,6-trimethylcyclohexa-1,3-dien-1-amine;hydrochloride.
| Compound Name | 4-(4-amino-3-methylphenyl)-2,6,6-trimethylcyclohexa-1,3-dien-1-amine;hydrochloride |
|---|---|
| PubChem CID | 66725208 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-(4-amino-3-methylphenyl)-2,6,6-trimethylcyclohexa-1,3-dien-1-amine;hydrochloride |
| SMILES | CC1=C(N)C(C)(C)CC(c2ccc(N)c(C)c2)=C1.Cl |
| InChI | InChI=1S/C16H22N2.ClH/c1-10-7-12(5-6-14(10)17)13-8-11(2)15(18)16(3,4)9-13;/h5-8H,9,17-18H2,1-4H3;1H |
| InChIKey | CGQQWMDFYZJOHH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|