C19H26NO7P — CID 66725315
2-[5-(2,3-dimethylindol-3-yl)-6-phosphonohexyl]propanedioic acid (PubChem CID 66725315) has the molecular formula C19H26NO7P and a molecular weight of 411.39 g/mol. Its IUPAC name is 2-[5-(2,3-dimethylindol-3-yl)-6-phosphonohexyl]propanedioic acid.
| Compound Name | 2-[5-(2,3-dimethylindol-3-yl)-6-phosphonohexyl]propanedioic acid |
|---|---|
| PubChem CID | 66725315 |
| Molecular Formula | C19H26NO7P |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[5-(2,3-dimethylindol-3-yl)-6-phosphonohexyl]propanedioic acid |
| SMILES | CC1=Nc2ccccc2C1(C)C(CCCCC(C(=O)O)C(=O)O)CP(=O)(O)O |
| InChI | InChI=1S/C19H26NO7P/c1-12-19(2,15-9-5-6-10-16(15)20-12)13(11-28(25,26)27)7-3-4-8-14(17(21)22)18(23)24/h5-6,9-10,13-14H,3-4,7-8,11H2,1-2H3,(H,21,22)(H,23,24)(H2,25,26,27) |
| InChIKey | RWXMCIRAMKHROO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|