About 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid
4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid (PubChem CID 66726115) has the molecular formula C15H16F4O4
and a molecular weight of 336.28 g/mol. Its IUPAC name is 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid.
Molecular Properties
| Compound Name | 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid |
| PubChem CID | 66726115 |
| Molecular Formula | C15H16F4O4 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid |
| SMILES | CC(C)(CC(O)(C(=O)O)C(F)(F)F)c1cc(F)cc2c1OCC2 |
| InChI | InChI=1S/C15H16F4O4/c1-13(2,7-14(22,12(20)21)15(17,18)19)10-6-9(16)5-8-3-4-23-11(8)10/h5-6,22H,3-4,7H2,1-2H3,(H,20,21) |
| InChIKey | ADRXTTZQSFNWGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid?
The IUPAC name of 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid (CID 66726115) is 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid.
What is the SMILES notation for 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid?
The canonical SMILES for 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid is CC(C)(CC(O)(C(=O)O)C(F)(F)F)c1cc(F)cc2c1OCC2.
What is the InChIKey of 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid?
The InChIKey is ADRXTTZQSFNWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F4O4/c1-13(2,7-14(22,12(20)21)15(17,18)19)10-6-9(16)5-8-3-4-23-11(8)10/h5-6,22H,3-4,7H2,1-2H3,(H,20,21).
What are the key properties of 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid?
4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid has a molecular weight of 336.28 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-2,3-dihydro-1-benzofuran-7-yl)-2-hydroxy-4-methyl-2-(trifluoromethyl)pentanoic acid is sourced from PubChem (CID 66726115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).