C34H59NO3 — CID 66726276
(7R)-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(6-hydroxyhexyl)-3-methyloctanamide (PubChem CID 66726276) has the molecular formula C34H59NO3 and a molecular weight of 529.85 g/mol. Its IUPAC name is (7R)-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(6-hydroxyhexyl)-3-methyloctanamide.
| Compound Name | (7R)-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(6-hydroxyhexyl)-3-methyloctanamide |
|---|---|
| PubChem CID | 66726276 |
| Molecular Formula | C34H59NO3 |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 529.45 |
| IUPAC Name | (7R)-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-N-(6-hydroxyhexyl)-3-methyloctanamide |
| SMILES | CC(CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)CC(=O)NCCCCCCO |
| InChI | InChI=1S/C34H59NO3/c1-24(22-32(38)35-20-7-5-6-8-21-36)10-9-11-25(2)29-14-15-30-28-13-12-26-23-27(37)16-18-33(26,3)31(28)17-19-34(29,30)4/h12,24-25,27-31,36-37H,5-11,13-23H2,1-4H3,(H,35,38)/t24?,25-,27+,28+,29-,30+,31+,33+,34-/m1/s1 |
| InChIKey | RPSFKQSVNPADAO-HNYWSAHOSA-N |
| XLogP | 7.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|