C28H34N4O7 — CID 66726603
[5-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamic acid (PubChem CID 66726603) has the molecular formula C28H34N4O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is [5-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamic acid.
| Compound Name | [5-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamic acid |
|---|---|
| PubChem CID | 66726603 |
| Molecular Formula | C28H34N4O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | [5-[[5-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamic acid |
| SMILES | CCOc1ccc(-c2nc(-c3ccc4c(c3)CCN4CC3(NC(=O)O)COC(C)(C)OC3)no2)cc1OCC |
| InChI | InChI=1S/C28H34N4O7/c1-5-35-22-10-8-20(14-23(22)36-6-2)25-29-24(31-39-25)19-7-9-21-18(13-19)11-12-32(21)15-28(30-26(33)34)16-37-27(3,4)38-17-28/h7-10,13-14,30H,5-6,11-12,15-17H2,1-4H3,(H,33,34) |
| InChIKey | MJBNQOFVOZQTRQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 128.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |