C19H24INO4 — CID 66726604
tert-butyl N-[5-[2-(4-iodophenyl)ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 66726604) has the molecular formula C19H24INO4 and a molecular weight of 457.31 g/mol. Its IUPAC name is tert-butyl N-[5-[2-(4-iodophenyl)ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[5-[2-(4-iodophenyl)ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 66726604 |
| Molecular Formula | C19H24INO4 |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | tert-butyl N-[5-[2-(4-iodophenyl)ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C#Cc2ccc(I)cc2)COC(C)(C)OC1 |
| InChI | InChI=1S/C19H24INO4/c1-17(2,3)25-16(22)21-19(12-23-18(4,5)24-13-19)11-10-14-6-8-15(20)9-7-14/h6-9H,12-13H2,1-5H3,(H,21,22) |
| InChIKey | DKAGDKFEKACNOH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|