C21H27N3O4S — CID 66726642
tert-butyl 4-isoquinolin-6-ylsulfonyl-3-methyl-2,3,5,8-tetrahydro-1,4-diazocine-1-carboxylate (PubChem CID 66726642) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is tert-butyl 4-isoquinolin-6-ylsulfonyl-3-methyl-2,3,5,8-tetrahydro-1,4-diazocine-1-carboxylate.
| Compound Name | tert-butyl 4-isoquinolin-6-ylsulfonyl-3-methyl-2,3,5,8-tetrahydro-1,4-diazocine-1-carboxylate |
|---|---|
| PubChem CID | 66726642 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | tert-butyl 4-isoquinolin-6-ylsulfonyl-3-methyl-2,3,5,8-tetrahydro-1,4-diazocine-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CC=CCN1S(=O)(=O)c1ccc2cnccc2c1 |
| InChI | InChI=1S/C21H27N3O4S/c1-16-15-23(20(25)28-21(2,3)4)11-5-6-12-24(16)29(26,27)19-8-7-18-14-22-10-9-17(18)13-19/h5-10,13-14,16H,11-12,15H2,1-4H3 |
| InChIKey | TYHKMMLSPJKQJC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|