C29H37N — CID 66726743
N-[[(1S,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-phenylprop-2-en-1-imine (PubChem CID 66726743) has the molecular formula C29H37N and a molecular weight of 399.62 g/mol. Its IUPAC name is N-[[(1S,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-phenylprop-2-en-1-imine.
| Compound Name | N-[[(1S,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 66726743 |
| Molecular Formula | C29H37N |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | N-[[(1S,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methyl]-3-phenylprop-2-en-1-imine |
| SMILES | CC(C)c1ccc2c(c1)CC[C@H]1[C@@](C)(C/N=C/C=Cc3ccccc3)CCC[C@]21C |
| InChI | InChI=1S/C29H37N/c1-22(2)24-13-15-26-25(20-24)14-16-27-28(3,17-9-18-29(26,27)4)21-30-19-8-12-23-10-6-5-7-11-23/h5-8,10-13,15,19-20,22,27H,9,14,16-18,21H2,1-4H3/b12-8?,30-19+/t27-,28+,29+/m0/s1 |
| InChIKey | YRLWLNDKNCBXFT-IBUCINJXSA-N |
| XLogP | 7.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|