C21H29NO3 — CID 66726850
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(methoxymethyl)-3-prop-2-enylpiperidine (PubChem CID 66726850) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(methoxymethyl)-3-prop-2-enylpiperidine.
| Compound Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(methoxymethyl)-3-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 66726850 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(methoxymethyl)-3-prop-2-enylpiperidine |
| SMILES | C=CCC1(COC)CCCN(C(C2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C21H29NO3/c1-3-10-21(17-23-2)11-7-12-22(16-21)20(18-8-5-4-6-9-18)19-15-24-13-14-25-19/h3-5,8,13-15,20H,1,6-7,9-12,16-17H2,2H3 |
| InChIKey | XTRHCVRGIOYJLU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|