C20H27NO3 — CID 66726862
[1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 66726862) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is [1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol.
| Compound Name | [1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 66726862 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CCC1(CO)CCCN(C(C2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C20H27NO3/c1-2-9-20(16-22)10-6-11-21(15-20)19(17-7-4-3-5-8-17)18-14-23-12-13-24-18/h2-4,7,12-14,19,22H,1,5-6,8-11,15-16H2 |
| InChIKey | WMLMELAJLBCSHB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|