C20H25NO2 — CID 66726931
2-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline (PubChem CID 66726931) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is 2-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline.
| Compound Name | 2-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 66726931 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline |
| SMILES | C1=CCCC(C(C2=COC=CO2)N2CCC3=C(CCCC3)C2)=C1 |
| InChI | InChI=1S/C20H25NO2/c1-2-7-17(8-3-1)20(19-15-22-12-13-23-19)21-11-10-16-6-4-5-9-18(16)14-21/h1-2,7,12-13,15,20H,3-6,8-11,14H2 |
| InChIKey | SPNCDIREMJKKOU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|