C22H31BrN4O3Si — CID 66726972
(3R,4R)-3-[12-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylic acid (PubChem CID 66726972) has the molecular formula C22H31BrN4O3Si and a molecular weight of 507.51 g/mol. Its IUPAC name is (3R,4R)-3-[12-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylic acid.
| Compound Name | (3R,4R)-3-[12-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66726972 |
| Molecular Formula | C22H31BrN4O3Si |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | (3R,4R)-3-[12-bromo-10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-4-methylpiperidine-1-carboxylic acid |
| SMILES | C[C@@H]1CCN(C(=O)O)C[C@@H]1n1ccc2cnc3c(c(Br)cn3COCC[Si](C)(C)C)c21 |
| InChI | InChI=1S/C22H31BrN4O3Si/c1-15-5-7-25(22(28)29)13-18(15)27-8-6-16-11-24-21-19(20(16)27)17(23)12-26(21)14-30-9-10-31(2,3)4/h6,8,11-12,15,18H,5,7,9-10,13-14H2,1-4H3,(H,28,29)/t15-,18+/m1/s1 |
| InChIKey | GFODOAJNJYPUNI-QAPCUYQASA-N |
| XLogP | 5.63 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|