C28H35N3O3Si — CID 66726980
2-[4-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]benzoic acid (PubChem CID 66726980) has the molecular formula C28H35N3O3Si and a molecular weight of 489.69 g/mol. Its IUPAC name is 2-[4-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]benzoic acid.
| Compound Name | 2-[4-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]benzoic acid |
|---|---|
| PubChem CID | 66726980 |
| Molecular Formula | C28H35N3O3Si |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[4-[10-(2-trimethylsilylethoxymethyl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]benzoic acid |
| SMILES | C[Si](C)(C)CCOCn1ccc2c1ncc1ccn(C3CCC(c4ccccc4C(=O)O)CC3)c12 |
| InChI | InChI=1S/C28H35N3O3Si/c1-35(2,3)17-16-34-19-30-14-13-25-26-21(18-29-27(25)30)12-15-31(26)22-10-8-20(9-11-22)23-6-4-5-7-24(23)28(32)33/h4-7,12-15,18,20,22H,8-11,16-17,19H2,1-3H3,(H,32,33) |
| InChIKey | MHIIZMRSDYNVAE-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|