C17H21NO2 — CID 66727122
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-5-methyl-3,6-dihydro-2H-pyridine (PubChem CID 66727122) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-5-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-5-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 66727122 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-5-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCCN(C(C2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C17H21NO2/c1-14-6-5-9-18(12-14)17(15-7-3-2-4-8-15)16-13-19-10-11-20-16/h2-3,6-7,10-11,13,17H,4-5,8-9,12H2,1H3 |
| InChIKey | XSLPAZYWYIZUQJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|