C22H31NO3 — CID 66727279
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(ethoxymethyl)-3-prop-2-enylpiperidine (PubChem CID 66727279) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(ethoxymethyl)-3-prop-2-enylpiperidine.
| Compound Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(ethoxymethyl)-3-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 66727279 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3-(ethoxymethyl)-3-prop-2-enylpiperidine |
| SMILES | C=CCC1(COCC)CCCN(C(C2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C22H31NO3/c1-3-11-22(18-24-4-2)12-8-13-23(17-22)21(19-9-6-5-7-10-19)20-16-25-14-15-26-20/h3,5-6,9,14-16,21H,1,4,7-8,10-13,17-18H2,2H3 |
| InChIKey | QXJYMXYBTUTLTH-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|