C18H23NO2 — CID 66727342
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine (PubChem CID 66727342) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 66727342 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-3,5-dimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CC(C)CN(C(C2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C18H23NO2/c1-14-10-15(2)12-19(11-14)18(16-6-4-3-5-7-16)17-13-20-8-9-21-17/h3-4,6,8-10,13-14,18H,5,7,11-12H2,1-2H3 |
| InChIKey | CIIAQKLRDJHHRQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|