C16H21NO3 — CID 66727520
1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidin-3-ol (PubChem CID 66727520) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidin-3-ol.
| Compound Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 66727520 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]piperidin-3-ol |
| SMILES | OC1CCCN(C(C2=CC=CCC2)C2=COC=CO2)C1 |
| InChI | InChI=1S/C16H21NO3/c18-14-7-4-8-17(11-14)16(13-5-2-1-3-6-13)15-12-19-9-10-20-15/h1-2,5,9-10,12,14,16,18H,3-4,6-8,11H2 |
| InChIKey | GBMFWVQDDPFUHW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |