About N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine
N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 66727559) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 66727559 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | C1=CCCC(NCC2=COC=CO2)=C1 |
| InChI | InChI=1S/C11H13NO2/c1-2-4-10(5-3-1)12-8-11-9-13-6-7-14-11/h1-2,4,6-7,9,12H,3,5,8H2 |
| InChIKey | DXDZRIDDRYGZEB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine (CID 66727559) is N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine is C1=CCCC(NCC2=COC=CO2)=C1.
What is the InChIKey of N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine?
The InChIKey is DXDZRIDDRYGZEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-4-10(5-3-1)12-8-11-9-13-6-7-14-11/h1-2,4,6-7,9,12H,3,5,8H2.
What are the key properties of N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine?
N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine has a molecular weight of 191.23 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxin-2-ylmethyl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 66727559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).