C40H36FN5O4S — CID 66727588
methyl 2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-3-tritylsulfanylpropanoate (PubChem CID 66727588) has the molecular formula C40H36FN5O4S and a molecular weight of 701.82 g/mol. Its IUPAC name is methyl 2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-3-tritylsulfanylpropanoate.
| Compound Name | methyl 2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-3-tritylsulfanylpropanoate |
|---|---|
| PubChem CID | 66727588 |
| Molecular Formula | C40H36FN5O4S |
| Molecular Weight | 701.82 g/mol |
| Exact Mass | 701.25 |
| IUPAC Name | methyl 2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-3-tritylsulfanylpropanoate |
| SMILES | CCC(NC(=O)c1cncc2c1cnn2-c1ccc(F)cc1)C(=O)NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C40H36FN5O4S/c1-3-34(44-37(47)33-23-42-25-36-32(33)24-43-46(36)31-21-19-30(41)20-22-31)38(48)45-35(39(49)50-2)26-51-40(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-25,34-35H,3,26H2,1-2H3,(H,44,47)(H,45,48) |
| InChIKey | FGVXDAZBCFEAIU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.82 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|