C21H23F4N5O2 — CID 66727732
2-amino-6-[2-fluoro-5-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one (PubChem CID 66727732) has the molecular formula C21H23F4N5O2 and a molecular weight of 453.44 g/mol. Its IUPAC name is 2-amino-6-[2-fluoro-5-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one.
| Compound Name | 2-amino-6-[2-fluoro-5-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
|---|---|
| PubChem CID | 66727732 |
| Molecular Formula | C21H23F4N5O2 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-amino-6-[2-fluoro-5-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]amino]phenyl]-3,5,5,6-tetramethylpyrimidin-4-one |
| SMILES | CN1C(=O)C(C)(C)C(C)(c2cc(Nc3ccc(OCC(F)(F)F)nc3)ccc2F)N=C1N |
| InChI | InChI=1S/C21H23F4N5O2/c1-19(2)17(31)30(4)18(26)29-20(19,3)14-9-12(5-7-15(14)22)28-13-6-8-16(27-10-13)32-11-21(23,24)25/h5-10,28H,11H2,1-4H3,(H2,26,29) |
| InChIKey | NXPOBAAAVKDOEM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |